C14H10Cl4N2O2 — CID 108880841
1-[(2,4-dichlorophenoxy)methyl]-3-(3,4-dichlorophenyl)urea (PubChem CID 108880841) has the molecular formula C14H10Cl4N2O2 and a molecular weight of 380.06 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenoxy)methyl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[(2,4-dichlorophenoxy)methyl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 108880841 |
| Molecular Formula | C14H10Cl4N2O2 |
| Molecular Weight | 380.06 g/mol |
| Exact Mass | 377.95 |
| IUPAC Name | 1-[(2,4-dichlorophenoxy)methyl]-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(NCOc1ccc(Cl)cc1Cl)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl4N2O2/c15-8-1-4-13(12(18)5-8)22-7-19-14(21)20-9-2-3-10(16)11(17)6-9/h1-6H,7H2,(H2,19,20,21) |
| InChIKey | QVSRYPQRNKCXFQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.06 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|