C16H11Cl4NO4 — CID 1349237
[2-(3,4-dichloroanilino)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 1349237) has the molecular formula C16H11Cl4NO4 and a molecular weight of 423.08 g/mol. Its IUPAC name is [2-(3,4-dichloroanilino)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [2-(3,4-dichloroanilino)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 1349237 |
| Molecular Formula | C16H11Cl4NO4 |
| Molecular Weight | 423.08 g/mol |
| Exact Mass | 420.94 |
| IUPAC Name | [2-(3,4-dichloroanilino)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | O=C(COC(=O)COc1ccc(Cl)cc1Cl)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl4NO4/c17-9-1-4-14(13(20)5-9)24-8-16(23)25-7-15(22)21-10-2-3-11(18)12(19)6-10/h1-6H,7-8H2,(H,21,22) |
| InChIKey | WLEHSZGLRWRGOO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.08 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |