C19H19Cl2NO4 — CID 2378781
[2-oxo-2-(2-propan-2-ylanilino)ethyl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 2378781) has the molecular formula C19H19Cl2NO4 and a molecular weight of 396.27 g/mol. Its IUPAC name is [2-oxo-2-(2-propan-2-ylanilino)ethyl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [2-oxo-2-(2-propan-2-ylanilino)ethyl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 2378781 |
| Molecular Formula | C19H19Cl2NO4 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | [2-oxo-2-(2-propan-2-ylanilino)ethyl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | CC(C)c1ccccc1NC(=O)COC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H19Cl2NO4/c1-12(2)14-5-3-4-6-16(14)22-18(23)10-26-19(24)11-25-17-8-7-13(20)9-15(17)21/h3-9,12H,10-11H2,1-2H3,(H,22,23) |
| InChIKey | FRCUSQYZZMVERO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |