C16H10Cl2F3NO4 — CID 2433678
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 2433678) has the molecular formula C16H10Cl2F3NO4 and a molecular weight of 408.16 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 2433678 |
| Molecular Formula | C16H10Cl2F3NO4 |
| Molecular Weight | 408.16 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | O=C(COC(=O)COc1ccc(Cl)cc1Cl)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H10Cl2F3NO4/c17-8-1-4-12(9(18)5-8)25-7-14(24)26-6-13(23)22-11-3-2-10(19)15(20)16(11)21/h1-5H,6-7H2,(H,22,23) |
| InChIKey | LCUXFOMXOFNZJJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.16 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|