C15H17Cl2NO4 — CID 3987255
[2-(cyclopentylamino)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 3987255) has the molecular formula C15H17Cl2NO4 and a molecular weight of 346.21 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 3987255 |
| Molecular Formula | C15H17Cl2NO4 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | O=C(COC(=O)COc1ccc(Cl)cc1Cl)NC1CCCC1 |
| InChI | InChI=1S/C15H17Cl2NO4/c16-10-5-6-13(12(17)7-10)21-9-15(20)22-8-14(19)18-11-3-1-2-4-11/h5-7,11H,1-4,8-9H2,(H,18,19) |
| InChIKey | XLXAQPFCTYJTTA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |