C17H20Cl2N2O4 — CID 7843884
[2-(cyclohexylamino)-2-oxoethyl] 2-[(2,4-dichlorobenzoyl)amino]acetate (PubChem CID 7843884) has the molecular formula C17H20Cl2N2O4 and a molecular weight of 387.26 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 2-[(2,4-dichlorobenzoyl)amino]acetate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 2-[(2,4-dichlorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7843884 |
| Molecular Formula | C17H20Cl2N2O4 |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 2-[(2,4-dichlorobenzoyl)amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccc(Cl)cc1Cl)NC1CCCCC1 |
| InChI | InChI=1S/C17H20Cl2N2O4/c18-11-6-7-13(14(19)8-11)17(24)20-9-16(23)25-10-15(22)21-12-4-2-1-3-5-12/h6-8,12H,1-5,9-10H2,(H,20,24)(H,21,22) |
| InChIKey | VGAUVPDPBXKPCD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |