C21H23Cl2NO4 — CID 4299627
[2-(1-adamantyl)-2-oxoethyl] 2-[(2,4-dichlorobenzoyl)amino]acetate (PubChem CID 4299627) has the molecular formula C21H23Cl2NO4 and a molecular weight of 424.32 g/mol. Its IUPAC name is [2-(1-adamantyl)-2-oxoethyl] 2-[(2,4-dichlorobenzoyl)amino]acetate.
| Compound Name | [2-(1-adamantyl)-2-oxoethyl] 2-[(2,4-dichlorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 4299627 |
| Molecular Formula | C21H23Cl2NO4 |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | [2-(1-adamantyl)-2-oxoethyl] 2-[(2,4-dichlorobenzoyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1ccc(Cl)cc1Cl)OCC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H23Cl2NO4/c22-15-1-2-16(17(23)6-15)20(27)24-10-19(26)28-11-18(25)21-7-12-3-13(8-21)5-14(4-12)9-21/h1-2,6,12-14H,3-5,7-11H2,(H,24,27) |
| InChIKey | KAPRBRMWCGVGSI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |