C26H29NO4 — CID 8573277
[2-(1-adamantyl)-2-oxoethyl] 2-[(2-naphthalen-1-ylacetyl)amino]acetate (PubChem CID 8573277) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is [2-(1-adamantyl)-2-oxoethyl] 2-[(2-naphthalen-1-ylacetyl)amino]acetate.
| Compound Name | [2-(1-adamantyl)-2-oxoethyl] 2-[(2-naphthalen-1-ylacetyl)amino]acetate |
|---|---|
| PubChem CID | 8573277 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | [2-(1-adamantyl)-2-oxoethyl] 2-[(2-naphthalen-1-ylacetyl)amino]acetate |
| SMILES | O=C(Cc1cccc2ccccc12)NCC(=O)OCC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H29NO4/c28-23(26-12-17-8-18(13-26)10-19(9-17)14-26)16-31-25(30)15-27-24(29)11-21-6-3-5-20-4-1-2-7-22(20)21/h1-7,17-19H,8-16H2,(H,27,29) |
| InChIKey | XVFBOIOGRXNKFG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |