C22H25N3O5 — CID 9070858
[2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 2-[(2-naphthalen-1-ylacetyl)amino]acetate (PubChem CID 9070858) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 2-[(2-naphthalen-1-ylacetyl)amino]acetate.
| Compound Name | [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 2-[(2-naphthalen-1-ylacetyl)amino]acetate |
|---|---|
| PubChem CID | 9070858 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 2-[(2-naphthalen-1-ylacetyl)amino]acetate |
| SMILES | NC(=O)[C@H]1CCCCN1C(=O)COC(=O)CNC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C22H25N3O5/c23-22(29)18-10-3-4-11-25(18)20(27)14-30-21(28)13-24-19(26)12-16-8-5-7-15-6-1-2-9-17(15)16/h1-2,5-9,18H,3-4,10-14H2,(H2,23,29)(H,24,26)/t18-/m1/s1 |
| InChIKey | OTHVNHCATBKFDM-GOSISDBHSA-N |
| XLogP | 0.91 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |