C23H25N3O5 — CID 9492409
[2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 2-[(4-phenylbenzoyl)amino]acetate (PubChem CID 9492409) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 2-[(4-phenylbenzoyl)amino]acetate.
| Compound Name | [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 2-[(4-phenylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 9492409 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | [2-[(2R)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 2-[(4-phenylbenzoyl)amino]acetate |
| SMILES | NC(=O)[C@H]1CCCCN1C(=O)COC(=O)CNC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25N3O5/c24-22(29)19-8-4-5-13-26(19)20(27)15-31-21(28)14-25-23(30)18-11-9-17(10-12-18)16-6-2-1-3-7-16/h1-3,6-7,9-12,19H,4-5,8,13-15H2,(H2,24,29)(H,25,30)/t19-/m1/s1 |
| InChIKey | RTRHBJMQFDWTSP-LJQANCHMSA-N |
| XLogP | 1.49 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |