C22H22N2O5 — CID 8808423
[2-[(2S)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 4-benzoylbenzoate (PubChem CID 8808423) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is [2-[(2S)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 4-benzoylbenzoate.
| Compound Name | [2-[(2S)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 4-benzoylbenzoate |
|---|---|
| PubChem CID | 8808423 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [2-[(2S)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 4-benzoylbenzoate |
| SMILES | NC(=O)[C@@H]1CCCCN1C(=O)COC(=O)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N2O5/c23-21(27)18-8-4-5-13-24(18)19(25)14-29-22(28)17-11-9-16(10-12-17)20(26)15-6-2-1-3-7-15/h1-3,6-7,9-12,18H,4-5,8,13-14H2,(H2,23,27)/t18-/m0/s1 |
| InChIKey | GKNNTGNQDLLWQP-SFHVURJKSA-N |
| XLogP | 1.94 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |