C22H23NO4 — CID 18078989
[2-(3-methylpiperidin-1-yl)-2-oxoethyl] 4-benzoylbenzoate (PubChem CID 18078989) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 4-benzoylbenzoate.
| Compound Name | [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 4-benzoylbenzoate |
|---|---|
| PubChem CID | 18078989 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 4-benzoylbenzoate |
| SMILES | CC1CCCN(C(=O)COC(=O)c2ccc(C(=O)c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C22H23NO4/c1-16-6-5-13-23(14-16)20(24)15-27-22(26)19-11-9-18(10-12-19)21(25)17-7-3-2-4-8-17/h2-4,7-12,16H,5-6,13-15H2,1H3 |
| InChIKey | SGZWWUBWTXVQJT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |