C23H25NO5 — CID 8925634
[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl] 2-(4-benzoylphenoxy)acetate (PubChem CID 8925634) has the molecular formula C23H25NO5 and a molecular weight of 395.45 g/mol. Its IUPAC name is [2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl] 2-(4-benzoylphenoxy)acetate.
| Compound Name | [2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl] 2-(4-benzoylphenoxy)acetate |
|---|---|
| PubChem CID | 8925634 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | [2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl] 2-(4-benzoylphenoxy)acetate |
| SMILES | C[C@H]1CCCN(C(=O)COC(=O)COc2ccc(C(=O)c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C23H25NO5/c1-17-6-5-13-24(14-17)21(25)15-29-22(26)16-28-20-11-9-19(10-12-20)23(27)18-7-3-2-4-8-18/h2-4,7-12,17H,5-6,13-16H2,1H3/t17-/m0/s1 |
| InChIKey | JJTGSYHJGMDJIC-KRWDZBQOSA-N |
| XLogP | 3.10 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |