C16H20ClNO4 — CID 5017264
[2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-(4-chlorophenoxy)acetate (PubChem CID 5017264) has the molecular formula C16H20ClNO4 and a molecular weight of 325.79 g/mol. Its IUPAC name is [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-(4-chlorophenoxy)acetate.
| Compound Name | [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-(4-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 5017264 |
| Molecular Formula | C16H20ClNO4 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-(4-chlorophenoxy)acetate |
| SMILES | CC1CCCN(C(=O)COC(=O)COc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H20ClNO4/c1-12-3-2-8-18(9-12)15(19)10-22-16(20)11-21-14-6-4-13(17)5-7-14/h4-7,12H,2-3,8-11H2,1H3 |
| InChIKey | DWZBPTJCFFSGBS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |