C20H22ClNO4 — CID 8732428
[2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 2-(4-chloronaphthalen-1-yl)oxyacetate (PubChem CID 8732428) has the molecular formula C20H22ClNO4 and a molecular weight of 375.85 g/mol. Its IUPAC name is [2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 2-(4-chloronaphthalen-1-yl)oxyacetate.
| Compound Name | [2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 2-(4-chloronaphthalen-1-yl)oxyacetate |
|---|---|
| PubChem CID | 8732428 |
| Molecular Formula | C20H22ClNO4 |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | [2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 2-(4-chloronaphthalen-1-yl)oxyacetate |
| SMILES | C[C@@H]1CCCN(C(=O)COC(=O)COc2ccc(Cl)c3ccccc23)C1 |
| InChI | InChI=1S/C20H22ClNO4/c1-14-5-4-10-22(11-14)19(23)12-26-20(24)13-25-18-9-8-17(21)15-6-2-3-7-16(15)18/h2-3,6-9,14H,4-5,10-13H2,1H3/t14-/m1/s1 |
| InChIKey | UMOQYTMUVOCYRS-CQSZACIVSA-N |
| XLogP | 3.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |