C20H23NO4 — CID 8596245
[2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-methoxynaphthalene-1-carboxylate (PubChem CID 8596245) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is [2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-methoxynaphthalene-1-carboxylate.
| Compound Name | [2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-methoxynaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 8596245 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-methoxynaphthalene-1-carboxylate |
| SMILES | COc1ccc(C(=O)OCC(=O)N2CCC[C@@H](C)C2)c2ccccc12 |
| InChI | InChI=1S/C20H23NO4/c1-14-6-5-11-21(12-14)19(22)13-25-20(23)17-9-10-18(24-2)16-8-4-3-7-15(16)17/h3-4,7-10,14H,5-6,11-13H2,1-2H3/t14-/m1/s1 |
| InChIKey | UXXQOJSFAATJIC-CQSZACIVSA-N |
| XLogP | 3.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |