C14H18N2O4 — CID 4878205
[2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate (PubChem CID 4878205) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 4878205 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate |
| SMILES | CC1CCCN(C(=O)COC(=O)c2ccc[nH]c2=O)C1 |
| InChI | InChI=1S/C14H18N2O4/c1-10-4-3-7-16(8-10)12(17)9-20-14(19)11-5-2-6-15-13(11)18/h2,5-6,10H,3-4,7-9H2,1H3,(H,15,18) |
| InChIKey | ZEADELJNDAXDOF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |