C20H22N2O4 — CID 55355379
[2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-phenoxypyridine-3-carboxylate (PubChem CID 55355379) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-phenoxypyridine-3-carboxylate.
| Compound Name | [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-phenoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 55355379 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-phenoxypyridine-3-carboxylate |
| SMILES | CC1CCCN(C(=O)COC(=O)c2cccnc2Oc2ccccc2)C1 |
| InChI | InChI=1S/C20H22N2O4/c1-15-7-6-12-22(13-15)18(23)14-25-20(24)17-10-5-11-21-19(17)26-16-8-3-2-4-9-16/h2-5,8-11,15H,6-7,12-14H2,1H3 |
| InChIKey | UJHQXRRCZDCFLI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |