C23H21NO5 — CID 7969917
[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate (PubChem CID 7969917) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is [2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 7969917 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | [2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
| SMILES | C[C@H]1CCCN(C(=O)COC(=O)c2cccc3c2C(=O)c2ccccc2C3=O)C1 |
| InChI | InChI=1S/C23H21NO5/c1-14-6-5-11-24(12-14)19(25)13-29-23(28)18-10-4-9-17-20(18)22(27)16-8-3-2-7-15(16)21(17)26/h2-4,7-10,14H,5-6,11-13H2,1H3/t14-/m0/s1 |
| InChIKey | OSSGUYMOVKXZCF-AWEZNQCLSA-N |
| XLogP | 2.88 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|