C23H21NO6 — CID 7427415
[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate (PubChem CID 7427415) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 7427415 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)COC(=O)c2cccc3c2C(=O)c2ccccc2C3=O)C[C@H](C)O1 |
| InChI | InChI=1S/C23H21NO6/c1-13-10-24(11-14(2)30-13)19(25)12-29-23(28)18-9-5-8-17-20(18)22(27)16-7-4-3-6-15(16)21(17)26/h3-9,13-14H,10-12H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | CKUDMWQPQSTMIO-KBPBESRZSA-N |
| XLogP | 2.25 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|