C23H31N3O8 — CID 42988833
bis[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] pyridine-2,6-dicarboxylate (PubChem CID 42988833) has the molecular formula C23H31N3O8 and a molecular weight of 477.51 g/mol. Its IUPAC name is bis[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] pyridine-2,6-dicarboxylate.
| Compound Name | bis[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 42988833 |
| Molecular Formula | C23H31N3O8 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | bis[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] pyridine-2,6-dicarboxylate |
| SMILES | CC1CN(C(=O)COC(=O)c2cccc(C(=O)OCC(=O)N3CC(C)OC(C)C3)n2)CC(C)O1 |
| InChI | InChI=1S/C23H31N3O8/c1-14-8-25(9-15(2)33-14)20(27)12-31-22(29)18-6-5-7-19(24-18)23(30)32-13-21(28)26-10-16(3)34-17(4)11-26/h5-7,14-17H,8-13H2,1-4H3 |
| InChIKey | VYJQCGPHIUKRIW-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 124.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |