C15H17Cl2NO4 — CID 3545684
[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2,6-dichlorobenzoate (PubChem CID 3545684) has the molecular formula C15H17Cl2NO4 and a molecular weight of 346.21 g/mol. Its IUPAC name is [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2,6-dichlorobenzoate.
| Compound Name | [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 3545684 |
| Molecular Formula | C15H17Cl2NO4 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2,6-dichlorobenzoate |
| SMILES | CC1CN(C(=O)COC(=O)c2c(Cl)cccc2Cl)CC(C)O1 |
| InChI | InChI=1S/C15H17Cl2NO4/c1-9-6-18(7-10(2)22-9)13(19)8-21-15(20)14-11(16)4-3-5-12(14)17/h3-5,9-10H,6-8H2,1-2H3 |
| InChIKey | UGTPXQXEBKMHJY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |