C15H19ClN2O4 — CID 7509056
[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-amino-4-chlorobenzoate (PubChem CID 7509056) has the molecular formula C15H19ClN2O4 and a molecular weight of 326.78 g/mol. Its IUPAC name is [2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-amino-4-chlorobenzoate.
| Compound Name | [2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 7509056 |
| Molecular Formula | C15H19ClN2O4 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | [2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-amino-4-chlorobenzoate |
| SMILES | C[C@@H]1CN(C(=O)COC(=O)c2ccc(Cl)cc2N)C[C@@H](C)O1 |
| InChI | InChI=1S/C15H19ClN2O4/c1-9-6-18(7-10(2)22-9)14(19)8-21-15(20)12-4-3-11(16)5-13(12)17/h3-5,9-10H,6-8,17H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | ZYSOUUKAZCMOPC-NXEZZACHSA-N |
| XLogP | 1.71 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|