C18H19ClN2O4 — CID 9009952
[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-chloroquinoline-4-carboxylate (PubChem CID 9009952) has the molecular formula C18H19ClN2O4 and a molecular weight of 362.81 g/mol. Its IUPAC name is [2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-chloroquinoline-4-carboxylate.
| Compound Name | [2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-chloroquinoline-4-carboxylate |
|---|---|
| PubChem CID | 9009952 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | [2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-chloroquinoline-4-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)COC(=O)c2cc(Cl)nc3ccccc23)C[C@@H](C)O1 |
| InChI | InChI=1S/C18H19ClN2O4/c1-11-8-21(9-12(2)25-11)17(22)10-24-18(23)14-7-16(19)20-15-6-4-3-5-13(14)15/h3-7,11-12H,8-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | VHDCHOHXSJVWHI-VXGBXAGGSA-N |
| XLogP | 2.68 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|