C22H23NO5 — CID 7470890
[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-benzoylbenzoate (PubChem CID 7470890) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-benzoylbenzoate.
| Compound Name | [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-benzoylbenzoate |
|---|---|
| PubChem CID | 7470890 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-benzoylbenzoate |
| SMILES | C[C@@H]1CN(C(=O)COC(=O)c2ccccc2C(=O)c2ccccc2)C[C@H](C)O1 |
| InChI | InChI=1S/C22H23NO5/c1-15-12-23(13-16(2)28-15)20(24)14-27-22(26)19-11-7-6-10-18(19)21(25)17-8-4-3-5-9-17/h3-11,15-16H,12-14H2,1-2H3/t15-,16+ |
| InChIKey | KPWNEIFOROSGLB-IYBDPMFKSA-N |
| XLogP | 2.71 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |