C23H25NO4 — CID 7470676
[2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 2-benzoylbenzoate (PubChem CID 7470676) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is [2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 2-benzoylbenzoate.
| Compound Name | [2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 2-benzoylbenzoate |
|---|---|
| PubChem CID | 7470676 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | [2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 2-benzoylbenzoate |
| SMILES | C[C@@H]1C[C@H](C)CN(C(=O)COC(=O)c2ccccc2C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C23H25NO4/c1-16-12-17(2)14-24(13-16)21(25)15-28-23(27)20-11-7-6-10-19(20)22(26)18-8-4-3-5-9-18/h3-11,16-17H,12-15H2,1-2H3/t16-,17+ |
| InChIKey | BTIZOWQEVBRTHP-CALCHBBNSA-N |
| XLogP | 3.58 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |