C16H22N2O3 — CID 7781195
[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-aminobenzoate (PubChem CID 7781195) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is [2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-aminobenzoate.
| Compound Name | [2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-aminobenzoate |
|---|---|
| PubChem CID | 7781195 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | [2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-aminobenzoate |
| SMILES | C[C@H]1C[C@H](C)CN(C(=O)COC(=O)c2ccc(N)cc2)C1 |
| InChI | InChI=1S/C16H22N2O3/c1-11-7-12(2)9-18(8-11)15(19)10-21-16(20)13-3-5-14(17)6-4-13/h3-6,11-12H,7-10,17H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | AFEAHXLSIZHHMX-RYUDHWBXSA-N |
| XLogP | 1.93 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|