C16H21ClN2O5S — CID 2615168
[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate (PubChem CID 2615168) has the molecular formula C16H21ClN2O5S and a molecular weight of 388.87 g/mol. Its IUPAC name is [2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate.
| Compound Name | [2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 2615168 |
| Molecular Formula | C16H21ClN2O5S |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | [2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate |
| SMILES | C[C@@H]1C[C@@H](C)CN(C(=O)COC(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)C1 |
| InChI | InChI=1S/C16H21ClN2O5S/c1-10-5-11(2)8-19(7-10)15(20)9-24-16(21)12-3-4-13(17)14(6-12)25(18,22)23/h3-4,6,10-11H,5,7-9H2,1-2H3,(H2,18,22,23)/t10-,11-/m1/s1 |
| InChIKey | WNFOWNOSLUFKST-GHMZBOCLSA-N |
| XLogP | 1.65 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |