C22H31ClN2O5S — CID 55401048
[2-(azocan-1-yl)-2-oxoethyl] 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 55401048) has the molecular formula C22H31ClN2O5S and a molecular weight of 471.02 g/mol. Its IUPAC name is [2-(azocan-1-yl)-2-oxoethyl] 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | [2-(azocan-1-yl)-2-oxoethyl] 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 55401048 |
| Molecular Formula | C22H31ClN2O5S |
| Molecular Weight | 471.02 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | [2-(azocan-1-yl)-2-oxoethyl] 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CC1CCCN(S(=O)(=O)c2cc(C(=O)OCC(=O)N3CCCCCCC3)ccc2Cl)C1 |
| InChI | InChI=1S/C22H31ClN2O5S/c1-17-8-7-13-25(15-17)31(28,29)20-14-18(9-10-19(20)23)22(27)30-16-21(26)24-11-5-3-2-4-6-12-24/h9-10,14,17H,2-8,11-13,15-16H2,1H3 |
| InChIKey | OYACHCJHFYWHSW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.02 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |