C25H32ClNO5S — CID 3887722
[2-(1-adamantyl)-2-oxoethyl] 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 3887722) has the molecular formula C25H32ClNO5S and a molecular weight of 494.05 g/mol. Its IUPAC name is [2-(1-adamantyl)-2-oxoethyl] 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | [2-(1-adamantyl)-2-oxoethyl] 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 3887722 |
| Molecular Formula | C25H32ClNO5S |
| Molecular Weight | 494.05 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | [2-(1-adamantyl)-2-oxoethyl] 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CC1CCCN(S(=O)(=O)c2cc(C(=O)OCC(=O)C34CC5CC(CC(C5)C3)C4)ccc2Cl)C1 |
| InChI | InChI=1S/C25H32ClNO5S/c1-16-3-2-6-27(14-16)33(30,31)22-10-20(4-5-21(22)26)24(29)32-15-23(28)25-11-17-7-18(12-25)9-19(8-17)13-25/h4-5,10,16-19H,2-3,6-9,11-15H2,1H3 |
| InChIKey | IONHRCVLCWZLMO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.05 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |