C20H22ClNO5S — CID 18207366
(4-methoxyphenyl) 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 18207366) has the molecular formula C20H22ClNO5S and a molecular weight of 423.92 g/mol. Its IUPAC name is (4-methoxyphenyl) 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | (4-methoxyphenyl) 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 18207366 |
| Molecular Formula | C20H22ClNO5S |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | (4-methoxyphenyl) 4-chloro-3-(3-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | COc1ccc(OC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCC(C)C3)c2)cc1 |
| InChI | InChI=1S/C20H22ClNO5S/c1-14-4-3-11-22(13-14)28(24,25)19-12-15(5-10-18(19)21)20(23)27-17-8-6-16(26-2)7-9-17/h5-10,12,14H,3-4,11,13H2,1-2H3 |
| InChIKey | RRMKCQXBWBEMCZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|