C20H20ClNO6S — CID 2634024
(4-methoxycarbonylphenyl) 4-chloro-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 2634024) has the molecular formula C20H20ClNO6S and a molecular weight of 437.90 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl) 4-chloro-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (4-methoxycarbonylphenyl) 4-chloro-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2634024 |
| Molecular Formula | C20H20ClNO6S |
| Molecular Weight | 437.90 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | (4-methoxycarbonylphenyl) 4-chloro-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | COC(=O)c1ccc(OC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C20H20ClNO6S/c1-27-19(23)14-5-8-16(9-6-14)28-20(24)15-7-10-17(21)18(13-15)29(25,26)22-11-3-2-4-12-22/h5-10,13H,2-4,11-12H2,1H3 |
| InChIKey | YFOCRVZNTVIUEZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.90 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|