C19H26ClN3O5S — CID 30872528
methyl 4-chloro-3-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]sulfonylbenzoate (PubChem CID 30872528) has the molecular formula C19H26ClN3O5S and a molecular weight of 443.95 g/mol. Its IUPAC name is methyl 4-chloro-3-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 4-chloro-3-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 30872528 |
| Molecular Formula | C19H26ClN3O5S |
| Molecular Weight | 443.95 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | methyl 4-chloro-3-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCN(CC(=O)N3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C19H26ClN3O5S/c1-28-19(25)15-5-6-16(20)17(13-15)29(26,27)23-11-9-21(10-12-23)14-18(24)22-7-3-2-4-8-22/h5-6,13H,2-4,7-12,14H2,1H3 |
| InChIKey | XZMVRMKZUSOPFF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.95 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |