C12H14ClNO5S — CID 779077
methyl 4-chloro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 779077) has the molecular formula C12H14ClNO5S and a molecular weight of 319.77 g/mol. Its IUPAC name is methyl 4-chloro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | methyl 4-chloro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 779077 |
| Molecular Formula | C12H14ClNO5S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | methyl 4-chloro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | COC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C12H14ClNO5S/c1-18-12(15)9-2-3-10(13)11(8-9)20(16,17)14-4-6-19-7-5-14/h2-3,8H,4-7H2,1H3 |
| InChIKey | BBUJYJLXXUEWEX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |