C15H21ClN2O6S2 — CID 47080515
methyl 4-chloro-3-[4-[methyl(methylsulfonyl)amino]piperidin-1-yl]sulfonylbenzoate (PubChem CID 47080515) has the molecular formula C15H21ClN2O6S2 and a molecular weight of 424.93 g/mol. Its IUPAC name is methyl 4-chloro-3-[4-[methyl(methylsulfonyl)amino]piperidin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 4-chloro-3-[4-[methyl(methylsulfonyl)amino]piperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 47080515 |
| Molecular Formula | C15H21ClN2O6S2 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | methyl 4-chloro-3-[4-[methyl(methylsulfonyl)amino]piperidin-1-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCC(N(C)S(C)(=O)=O)CC2)c1 |
| InChI | InChI=1S/C15H21ClN2O6S2/c1-17(25(3,20)21)12-6-8-18(9-7-12)26(22,23)14-10-11(15(19)24-2)4-5-13(14)16/h4-5,10,12H,6-9H2,1-3H3 |
| InChIKey | MTMXJIJZKJEDFX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |