C17H19ClN2O6S3 — CID 30872655
methyl 4-chloro-3-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]sulfonylbenzoate (PubChem CID 30872655) has the molecular formula C17H19ClN2O6S3 and a molecular weight of 479.00 g/mol. Its IUPAC name is methyl 4-chloro-3-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 4-chloro-3-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 30872655 |
| Molecular Formula | C17H19ClN2O6S3 |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | methyl 4-chloro-3-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCC(NS(=O)(=O)c3cccs3)CC2)c1 |
| InChI | InChI=1S/C17H19ClN2O6S3/c1-26-17(21)12-4-5-14(18)15(11-12)29(24,25)20-8-6-13(7-9-20)19-28(22,23)16-3-2-10-27-16/h2-5,10-11,13,19H,6-9H2,1H3 |
| InChIKey | ZXXXDWCGVVYMKQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |