C17H23ClN2O5S — CID 96999446
methyl 4-chloro-3-[[1-[(3S)-oxolan-3-yl]piperidin-4-yl]sulfamoyl]benzoate (PubChem CID 96999446) has the molecular formula C17H23ClN2O5S and a molecular weight of 402.90 g/mol. Its IUPAC name is methyl 4-chloro-3-[[1-[(3S)-oxolan-3-yl]piperidin-4-yl]sulfamoyl]benzoate.
| Compound Name | methyl 4-chloro-3-[[1-[(3S)-oxolan-3-yl]piperidin-4-yl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 96999446 |
| Molecular Formula | C17H23ClN2O5S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | methyl 4-chloro-3-[[1-[(3S)-oxolan-3-yl]piperidin-4-yl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(S(=O)(=O)NC2CCN([C@H]3CCOC3)CC2)c1 |
| InChI | InChI=1S/C17H23ClN2O5S/c1-24-17(21)12-2-3-15(18)16(10-12)26(22,23)19-13-4-7-20(8-5-13)14-6-9-25-11-14/h2-3,10,13-14,19H,4-9,11H2,1H3/t14-/m0/s1 |
| InChIKey | NTSNGBLGBCAUDO-AWEZNQCLSA-N |
| XLogP | 1.66 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |