C14H20ClN3O3S — CID 97012651
6-chloro-N-[1-[(3R)-oxolan-3-yl]piperidin-4-yl]pyridine-3-sulfonamide (PubChem CID 97012651) has the molecular formula C14H20ClN3O3S and a molecular weight of 345.85 g/mol. Its IUPAC name is 6-chloro-N-[1-[(3R)-oxolan-3-yl]piperidin-4-yl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[1-[(3R)-oxolan-3-yl]piperidin-4-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 97012651 |
| Molecular Formula | C14H20ClN3O3S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 6-chloro-N-[1-[(3R)-oxolan-3-yl]piperidin-4-yl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NC1CCN([C@@H]2CCOC2)CC1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H20ClN3O3S/c15-14-2-1-13(9-16-14)22(19,20)17-11-3-6-18(7-4-11)12-5-8-21-10-12/h1-2,9,11-12,17H,3-8,10H2/t12-/m1/s1 |
| InChIKey | LLLVDPLFCYWTAF-GFCCVEGCSA-N |
| XLogP | 1.27 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|