C13H15ClN2O2S — CID 103765722
6-chloro-N-(3-tricyclo[3.2.1.02,4]octanyl)pyridine-3-sulfonamide (PubChem CID 103765722) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.80 g/mol. Its IUPAC name is 6-chloro-N-(3-tricyclo[3.2.1.02,4]octanyl)pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-(3-tricyclo[3.2.1.02,4]octanyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103765722 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 6-chloro-N-(3-tricyclo[3.2.1.02,4]octanyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NC1C2C3CCC(C3)C12)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C13H15ClN2O2S/c14-10-4-3-9(6-15-10)19(17,18)16-13-11-7-1-2-8(5-7)12(11)13/h3-4,6-8,11-13,16H,1-2,5H2 |
| InChIKey | SNKVXEBAQMVRJE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|