C10H12ClN3O3S — CID 43401368
2-[(6-chloro-3-pyridinyl)sulfonylamino]-N-cyclopropylacetamide (PubChem CID 43401368) has the molecular formula C10H12ClN3O3S and a molecular weight of 289.74 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)sulfonylamino]-N-cyclopropylacetamide.
| Compound Name | 2-[(6-chloro-3-pyridinyl)sulfonylamino]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 43401368 |
| Molecular Formula | C10H12ClN3O3S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)sulfonylamino]-N-cyclopropylacetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(Cl)nc1)NC1CC1 |
| InChI | InChI=1S/C10H12ClN3O3S/c11-9-4-3-8(5-12-9)18(16,17)13-6-10(15)14-7-1-2-7/h3-5,7,13H,1-2,6H2,(H,14,15) |
| InChIKey | ARZONQCIHIMCCN-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|