C9H13N5O3S — CID 62147002
2-[(2-aminopyrimidin-5-yl)sulfonylamino]-N-cyclopropylacetamide (PubChem CID 62147002) has the molecular formula C9H13N5O3S and a molecular weight of 271.30 g/mol. Its IUPAC name is 2-[(2-aminopyrimidin-5-yl)sulfonylamino]-N-cyclopropylacetamide.
| Compound Name | 2-[(2-aminopyrimidin-5-yl)sulfonylamino]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 62147002 |
| Molecular Formula | C9H13N5O3S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-[(2-aminopyrimidin-5-yl)sulfonylamino]-N-cyclopropylacetamide |
| SMILES | Nc1ncc(S(=O)(=O)NCC(=O)NC2CC2)cn1 |
| InChI | InChI=1S/C9H13N5O3S/c10-9-11-3-7(4-12-9)18(16,17)13-5-8(15)14-6-1-2-6/h3-4,6,13H,1-2,5H2,(H,14,15)(H2,10,11,12) |
| InChIKey | HWMAMBSFLFJXJL-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |