C12H15N3O5S — CID 81466367
3-amino-4-[[2-(cyclopropylamino)-2-oxoethyl]sulfamoyl]benzoic acid (PubChem CID 81466367) has the molecular formula C12H15N3O5S and a molecular weight of 313.33 g/mol. Its IUPAC name is 3-amino-4-[[2-(cyclopropylamino)-2-oxoethyl]sulfamoyl]benzoic acid.
| Compound Name | 3-amino-4-[[2-(cyclopropylamino)-2-oxoethyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 81466367 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3-amino-4-[[2-(cyclopropylamino)-2-oxoethyl]sulfamoyl]benzoic acid |
| SMILES | Nc1cc(C(=O)O)ccc1S(=O)(=O)NCC(=O)NC1CC1 |
| InChI | InChI=1S/C12H15N3O5S/c13-9-5-7(12(17)18)1-4-10(9)21(19,20)14-6-11(16)15-8-2-3-8/h1,4-5,8,14H,2-3,6,13H2,(H,15,16)(H,17,18) |
| InChIKey | CLBSLEKPSJWBGG-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|