C9H10F2N2O4S — CID 113303512
3-amino-4-(2,2-difluoroethylsulfamoyl)benzoic acid (PubChem CID 113303512) has the molecular formula C9H10F2N2O4S and a molecular weight of 280.25 g/mol. Its IUPAC name is 3-amino-4-(2,2-difluoroethylsulfamoyl)benzoic acid.
| Compound Name | 3-amino-4-(2,2-difluoroethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 113303512 |
| Molecular Formula | C9H10F2N2O4S |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 3-amino-4-(2,2-difluoroethylsulfamoyl)benzoic acid |
| SMILES | Nc1cc(C(=O)O)ccc1S(=O)(=O)NCC(F)F |
| InChI | InChI=1S/C9H10F2N2O4S/c10-8(11)4-13-18(16,17)7-2-1-5(9(14)15)3-6(7)12/h1-3,8,13H,4,12H2,(H,14,15) |
| InChIKey | CGGAWVIKSQGSFG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|