C12H16N2O4S2 — CID 106425421
3-amino-4-(2-prop-2-enylsulfanylethylsulfamoyl)benzoic acid (PubChem CID 106425421) has the molecular formula C12H16N2O4S2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-amino-4-(2-prop-2-enylsulfanylethylsulfamoyl)benzoic acid.
| Compound Name | 3-amino-4-(2-prop-2-enylsulfanylethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 106425421 |
| Molecular Formula | C12H16N2O4S2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 3-amino-4-(2-prop-2-enylsulfanylethylsulfamoyl)benzoic acid |
| SMILES | C=CCSCCNS(=O)(=O)c1ccc(C(=O)O)cc1N |
| InChI | InChI=1S/C12H16N2O4S2/c1-2-6-19-7-5-14-20(17,18)11-4-3-9(12(15)16)8-10(11)13/h2-4,8,14H,1,5-7,13H2,(H,15,16) |
| InChIKey | GFZIUXGOJRRQFD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|