C13H20N2O2S2 — CID 106425511
4-amino-2,6-dimethyl-N-(2-prop-2-enylsulfanylethyl)benzenesulfonamide (PubChem CID 106425511) has the molecular formula C13H20N2O2S2 and a molecular weight of 300.45 g/mol. Its IUPAC name is 4-amino-2,6-dimethyl-N-(2-prop-2-enylsulfanylethyl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dimethyl-N-(2-prop-2-enylsulfanylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106425511 |
| Molecular Formula | C13H20N2O2S2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 4-amino-2,6-dimethyl-N-(2-prop-2-enylsulfanylethyl)benzenesulfonamide |
| SMILES | C=CCSCCNS(=O)(=O)c1c(C)cc(N)cc1C |
| InChI | InChI=1S/C13H20N2O2S2/c1-4-6-18-7-5-15-19(16,17)13-10(2)8-12(14)9-11(13)3/h4,8-9,15H,1,5-7,14H2,2-3H3 |
| InChIKey | KYLVMJYIESCONJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|