C11H18N2O4S2 — CID 79588681
4-amino-2,6-dimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide (PubChem CID 79588681) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 4-amino-2,6-dimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79588681 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-amino-2,6-dimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide |
| SMILES | Cc1cc(N)cc(C)c1S(=O)(=O)NCCS(C)(=O)=O |
| InChI | InChI=1S/C11H18N2O4S2/c1-8-6-10(12)7-9(2)11(8)19(16,17)13-4-5-18(3,14)15/h6-7,13H,4-5,12H2,1-3H3 |
| InChIKey | GJEWFYTVPMEKLT-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|