C15H20N2O2S2 — CID 79570103
4-amino-N-[(4,5-dimethylthiophen-2-yl)methyl]-2,6-dimethylbenzenesulfonamide (PubChem CID 79570103) has the molecular formula C15H20N2O2S2 and a molecular weight of 324.47 g/mol. Its IUPAC name is 4-amino-N-[(4,5-dimethylthiophen-2-yl)methyl]-2,6-dimethylbenzenesulfonamide.
| Compound Name | 4-amino-N-[(4,5-dimethylthiophen-2-yl)methyl]-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 79570103 |
| Molecular Formula | C15H20N2O2S2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 4-amino-N-[(4,5-dimethylthiophen-2-yl)methyl]-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(CNS(=O)(=O)c2c(C)cc(N)cc2C)sc1C |
| InChI | InChI=1S/C15H20N2O2S2/c1-9-7-14(20-12(9)4)8-17-21(18,19)15-10(2)5-13(16)6-11(15)3/h5-7,17H,8,16H2,1-4H3 |
| InChIKey | VCHAGJYPGLSFDD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|