C13H14F2N2O2S2 — CID 107343635
3-amino-N-[(4,5-dimethylthiophen-2-yl)methyl]-2,4-difluorobenzenesulfonamide (PubChem CID 107343635) has the molecular formula C13H14F2N2O2S2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-amino-N-[(4,5-dimethylthiophen-2-yl)methyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | 3-amino-N-[(4,5-dimethylthiophen-2-yl)methyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 107343635 |
| Molecular Formula | C13H14F2N2O2S2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 3-amino-N-[(4,5-dimethylthiophen-2-yl)methyl]-2,4-difluorobenzenesulfonamide |
| SMILES | Cc1cc(CNS(=O)(=O)c2ccc(F)c(N)c2F)sc1C |
| InChI | InChI=1S/C13H14F2N2O2S2/c1-7-5-9(20-8(7)2)6-17-21(18,19)11-4-3-10(14)13(16)12(11)15/h3-5,17H,6,16H2,1-2H3 |
| InChIKey | RCDVFGLQIWPTEC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|