C10H12F2N2O2S — CID 107343822
3-amino-N-but-3-enyl-2,4-difluorobenzenesulfonamide (PubChem CID 107343822) has the molecular formula C10H12F2N2O2S and a molecular weight of 262.28 g/mol. Its IUPAC name is 3-amino-N-but-3-enyl-2,4-difluorobenzenesulfonamide.
| Compound Name | 3-amino-N-but-3-enyl-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 107343822 |
| Molecular Formula | C10H12F2N2O2S |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 3-amino-N-but-3-enyl-2,4-difluorobenzenesulfonamide |
| SMILES | C=CCCNS(=O)(=O)c1ccc(F)c(N)c1F |
| InChI | InChI=1S/C10H12F2N2O2S/c1-2-3-6-14-17(15,16)8-5-4-7(11)10(13)9(8)12/h2,4-5,14H,1,3,6,13H2 |
| InChIKey | BIIVJTUMTSURKD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|