C11H12F2N4O3S — CID 106413593
3-amino-2,4-difluoro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzenesulfonamide (PubChem CID 106413593) has the molecular formula C11H12F2N4O3S and a molecular weight of 318.31 g/mol. Its IUPAC name is 3-amino-2,4-difluoro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-amino-2,4-difluoro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106413593 |
| Molecular Formula | C11H12F2N4O3S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 3-amino-2,4-difluoro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1nc(CCNS(=O)(=O)c2ccc(F)c(N)c2F)no1 |
| InChI | InChI=1S/C11H12F2N4O3S/c1-6-16-9(17-20-6)4-5-15-21(18,19)8-3-2-7(12)11(14)10(8)13/h2-3,15H,4-5,14H2,1H3 |
| InChIKey | QFHPMKKWJXMZPY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|